C20H19N5O2 — CID 11473907
2-amino-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-(furan-2-yl)pyrimidine-4-carboxamide (PubChem CID 11473907) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-amino-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-(furan-2-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-amino-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-(furan-2-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 11473907 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-amino-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-(furan-2-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1[nH]c2ccc(CNC(=O)c3cc(-c4ccco4)nc(N)n3)cc2c1C |
| InChI | InChI=1S/C20H19N5O2/c1-11-12(2)23-15-6-5-13(8-14(11)15)10-22-19(26)17-9-16(24-20(21)25-17)18-4-3-7-27-18/h3-9,23H,10H2,1-2H3,(H,22,26)(H2,21,24,25) |
| InChIKey | RHCZXCXNLLBNPU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|