C13H16N2O — CID 26390650
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide (PubChem CID 26390650) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 26390650 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide |
| SMILES | CC(=O)NCc1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C13H16N2O/c1-8-9(2)15-13-5-4-11(6-12(8)13)7-14-10(3)16/h4-6,15H,7H2,1-3H3,(H,14,16) |
| InChIKey | IQUIXRQHCOLTGL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|