C18H25N3O2 — CID 26406442
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(4-hydroxypiperidin-1-yl)acetamide (PubChem CID 26406442) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(4-hydroxypiperidin-1-yl)acetamide.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(4-hydroxypiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 26406442 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-(4-hydroxypiperidin-1-yl)acetamide |
| SMILES | Cc1[nH]c2ccc(CNC(=O)CN3CCC(O)CC3)cc2c1C |
| InChI | InChI=1S/C18H25N3O2/c1-12-13(2)20-17-4-3-14(9-16(12)17)10-19-18(23)11-21-7-5-15(22)6-8-21/h3-4,9,15,20,22H,5-8,10-11H2,1-2H3,(H,19,23) |
| InChIKey | JVKVZQJROSUHEP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|