C23H32N4O4 — CID 124942272
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-[(2R)-2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]acetamide (PubChem CID 124942272) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-[(2R)-2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]acetamide.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-[(2R)-2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 124942272 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-[(2R)-2-methyl-2-(morpholine-4-carbonyl)morpholin-4-yl]acetamide |
| SMILES | Cc1[nH]c2ccc(CNC(=O)CN3CCO[C@@](C)(C(=O)N4CCOCC4)C3)cc2c1C |
| InChI | InChI=1S/C23H32N4O4/c1-16-17(2)25-20-5-4-18(12-19(16)20)13-24-21(28)14-26-6-11-31-23(3,15-26)22(29)27-7-9-30-10-8-27/h4-5,12,25H,6-11,13-15H2,1-3H3,(H,24,28)/t23-/m1/s1 |
| InChIKey | ATNIRVWHLRYOMF-HSZRJFAPSA-N |
| XLogP | 1.35 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|