C25H31N5O3 — CID 124969174
(2S)-1-[2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide (PubChem CID 124969174) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (2S)-1-[2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide.
| Compound Name | (2S)-1-[2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124969174 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (2S)-1-[2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(CC(=O)NCc3ccc4[nH]c(C)c(C)c4c3)[C@H](C(N)=O)C2)cc1 |
| InChI | InChI=1S/C25H31N5O3/c1-16-17(2)28-22-9-4-18(12-21(16)22)13-27-24(31)15-30-11-10-29(14-23(30)25(26)32)19-5-7-20(33-3)8-6-19/h4-9,12,23,28H,10-11,13-15H2,1-3H3,(H2,26,32)(H,27,31)/t23-/m0/s1 |
| InChIKey | JGVRNLSLHREVMV-QHCPKHFHSA-N |
| XLogP | 2.09 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|