C23H29N5O4 — CID 110152768
1-[2-(3-acetamido-4-methylanilino)-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide (PubChem CID 110152768) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[2-(3-acetamido-4-methylanilino)-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide.
| Compound Name | 1-[2-(3-acetamido-4-methylanilino)-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 110152768 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 1-[2-(3-acetamido-4-methylanilino)-2-oxoethyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3ccc(C)c(NC(C)=O)c3)C(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C23H29N5O4/c1-15-4-5-17(12-20(15)25-16(2)29)26-22(30)14-28-11-10-27(13-21(28)23(24)31)18-6-8-19(32-3)9-7-18/h4-9,12,21H,10-11,13-14H2,1-3H3,(H2,24,31)(H,25,29)(H,26,30) |
| InChIKey | IOQDMKQFDIFPGW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|