C16H23N3O2 — CID 41096237
(2S)-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-2-carboxamide (PubChem CID 41096237) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S)-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 41096237 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2S)-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CN2CCCC[C@H]2C(N)=O)cc1C |
| InChI | InChI=1S/C16H23N3O2/c1-11-6-7-13(9-12(11)2)18-15(20)10-19-8-4-3-5-14(19)16(17)21/h6-7,9,14H,3-5,8,10H2,1-2H3,(H2,17,21)(H,18,20)/t14-/m0/s1 |
| InChIKey | HYFAOIVLXGRZIE-AWEZNQCLSA-N |
| XLogP | 1.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |