C17H25N3O5 — CID 40918330
(2S)-1-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]piperidine-2-carboxamide (PubChem CID 40918330) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2S)-1-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 40918330 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-1-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]piperidine-2-carboxamide |
| SMILES | COc1cc(NC(=O)CN2CCCC[C@H]2C(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H25N3O5/c1-23-13-8-11(9-14(24-2)16(13)25-3)19-15(21)10-20-7-5-4-6-12(20)17(18)22/h8-9,12H,4-7,10H2,1-3H3,(H2,18,22)(H,19,21)/t12-/m0/s1 |
| InChIKey | RRUSNMXBRJFEGM-LBPRGKRZSA-N |
| XLogP | 0.99 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |