C21H25ClN2O4 — CID 42950760
2-[2-(4-chlorophenyl)pyrrolidin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 42950760) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)pyrrolidin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)pyrrolidin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42950760 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[2-(4-chlorophenyl)pyrrolidin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CN2CCCC2c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25ClN2O4/c1-26-18-11-16(12-19(27-2)21(18)28-3)23-20(25)13-24-10-4-5-17(24)14-6-8-15(22)9-7-14/h6-9,11-12,17H,4-5,10,13H2,1-3H3,(H,23,25) |
| InChIKey | NLAGDSBSZWBHFU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |