C24H29N5O5 — CID 125002159
(2R)-4-(4-methoxyphenyl)-1-[2-oxo-2-[(2-oxo-3-propyl-1,3-benzoxazol-6-yl)amino]ethyl]piperazine-2-carboxamide (PubChem CID 125002159) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is (2R)-4-(4-methoxyphenyl)-1-[2-oxo-2-[(2-oxo-3-propyl-1,3-benzoxazol-6-yl)amino]ethyl]piperazine-2-carboxamide.
| Compound Name | (2R)-4-(4-methoxyphenyl)-1-[2-oxo-2-[(2-oxo-3-propyl-1,3-benzoxazol-6-yl)amino]ethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 125002159 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (2R)-4-(4-methoxyphenyl)-1-[2-oxo-2-[(2-oxo-3-propyl-1,3-benzoxazol-6-yl)amino]ethyl]piperazine-2-carboxamide |
| SMILES | CCCn1c(=O)oc2cc(NC(=O)CN3CCN(c4ccc(OC)cc4)C[C@@H]3C(N)=O)ccc21 |
| InChI | InChI=1S/C24H29N5O5/c1-3-10-29-19-9-4-16(13-21(19)34-24(29)32)26-22(30)15-28-12-11-27(14-20(28)23(25)31)17-5-7-18(33-2)8-6-17/h4-9,13,20H,3,10-12,14-15H2,1-2H3,(H2,25,31)(H,26,30)/t20-/m1/s1 |
| InChIKey | SIJBPCHMHVNKRT-HXUWFJFHSA-N |
| XLogP | 1.63 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|