C26H35N5O4 — CID 129455255
(2S)-4-(4-methoxyphenyl)-N,N-dimethyl-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperazine-2-carboxamide (PubChem CID 129455255) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is (2S)-4-(4-methoxyphenyl)-N,N-dimethyl-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperazine-2-carboxamide.
| Compound Name | (2S)-4-(4-methoxyphenyl)-N,N-dimethyl-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 129455255 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (2S)-4-(4-methoxyphenyl)-N,N-dimethyl-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3ccc(N4CCOCC4)cc3)[C@H](C(=O)N(C)C)C2)cc1 |
| InChI | InChI=1S/C26H35N5O4/c1-28(2)26(33)24-18-30(22-8-10-23(34-3)11-9-22)12-13-31(24)19-25(32)27-20-4-6-21(7-5-20)29-14-16-35-17-15-29/h4-11,24H,12-19H2,1-3H3,(H,27,32)/t24-/m0/s1 |
| InChIKey | HSAFUTVDNZBCHK-DEOSSOPVSA-N |
| XLogP | 1.75 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|