C24H34N6O3 — CID 125019309
(2R)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperazine-2-carboxamide (PubChem CID 125019309) has the molecular formula C24H34N6O3 and a molecular weight of 454.58 g/mol. Its IUPAC name is (2R)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperazine-2-carboxamide.
| Compound Name | (2R)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 125019309 |
| Molecular Formula | C24H34N6O3 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (2R)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3ccnn3C3CCCC3)[C@@H](C(=O)N(C)C)C2)cc1 |
| InChI | InChI=1S/C24H34N6O3/c1-27(2)24(32)21-16-28(18-8-10-20(33-3)11-9-18)14-15-29(21)17-23(31)26-22-12-13-25-30(22)19-6-4-5-7-19/h8-13,19,21H,4-7,14-17H2,1-3H3,(H,26,31)/t21-/m1/s1 |
| InChIKey | XUZMVAXXBCQZGB-OAQYLSRUSA-N |
| XLogP | 2.22 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|