C15H22N4O3 — CID 95821736
(2S)-1-(2-amino-2-oxoethyl)-4-(4-methoxyphenyl)-N-methylpiperazine-2-carboxamide (PubChem CID 95821736) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2S)-1-(2-amino-2-oxoethyl)-4-(4-methoxyphenyl)-N-methylpiperazine-2-carboxamide.
| Compound Name | (2S)-1-(2-amino-2-oxoethyl)-4-(4-methoxyphenyl)-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 95821736 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2S)-1-(2-amino-2-oxoethyl)-4-(4-methoxyphenyl)-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CN(c2ccc(OC)cc2)CCN1CC(N)=O |
| InChI | InChI=1S/C15H22N4O3/c1-17-15(21)13-9-18(7-8-19(13)10-14(16)20)11-3-5-12(22-2)6-4-11/h3-6,13H,7-10H2,1-2H3,(H2,16,20)(H,17,21)/t13-/m0/s1 |
| InChIKey | AOUOEWJRUWMVHH-ZDUSSCGKSA-N |
| XLogP | -0.58 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|