C24H31FN4O3 — CID 110152315
1-[[1-(4-fluorophenyl)-4-hydroxypiperidin-4-yl]methyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide (PubChem CID 110152315) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)-4-hydroxypiperidin-4-yl]methyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide.
| Compound Name | 1-[[1-(4-fluorophenyl)-4-hydroxypiperidin-4-yl]methyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 110152315 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)-4-hydroxypiperidin-4-yl]methyl]-4-(4-methoxyphenyl)piperazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(CC3(O)CCN(c4ccc(F)cc4)CC3)C(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C24H31FN4O3/c1-32-21-8-6-20(7-9-21)28-14-15-29(22(16-28)23(26)30)17-24(31)10-12-27(13-11-24)19-4-2-18(25)3-5-19/h2-9,22,31H,10-17H2,1H3,(H2,26,30) |
| InChIKey | CMKWOHYMABELCO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|