C17H17FN2O3 — CID 101388593
(2R)-2-(4-fluorophenoxy)-2-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]acetamide (PubChem CID 101388593) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenoxy)-2-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]acetamide.
| Compound Name | (2R)-2-(4-fluorophenoxy)-2-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]acetamide |
|---|---|
| PubChem CID | 101388593 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2R)-2-(4-fluorophenoxy)-2-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]acetamide |
| SMILES | COc1ccc(N2C[C@H]2[C@@H](Oc2ccc(F)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C17H17FN2O3/c1-22-13-8-4-12(5-9-13)20-10-15(20)16(17(19)21)23-14-6-2-11(18)3-7-14/h2-9,15-16H,10H2,1H3,(H2,19,21)/t15-,16+,20?/m0/s1 |
| InChIKey | SSFQDNQBURYKPX-QRFGBVCESA-N |
| XLogP | 1.96 |
| TPSA | 64.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|