C20H19FN5O4+ — CID 156591185
N-(4-fluorophenyl)-2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetamide (PubChem CID 156591185) has the molecular formula C20H19FN5O4+ and a molecular weight of 412.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetamide |
|---|---|
| PubChem CID | 156591185 |
| Molecular Formula | C20H19FN5O4+ |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetamide |
| SMILES | COc1ccc(N2CCN3C(=O)C(=O)[N+](CC(=O)Nc4ccc(F)cc4)=NC32)cc1 |
| InChI | InChI=1S/C20H18FN5O4/c1-30-16-8-6-15(7-9-16)24-10-11-25-18(28)19(29)26(23-20(24)25)12-17(27)22-14-4-2-13(21)3-5-14/h2-9,20H,10-12H2,1H3/p+1 |
| InChIKey | QPCWRRCRRXKROA-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|