C21H21N6O5+ — CID 156591017
4-[[2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetyl]amino]benzamide (PubChem CID 156591017) has the molecular formula C21H21N6O5+ and a molecular weight of 437.44 g/mol. Its IUPAC name is 4-[[2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 156591017 |
| Molecular Formula | C21H21N6O5+ |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-[[2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]acetyl]amino]benzamide |
| SMILES | COc1ccc(N2CCN3C(=O)C(=O)[N+](CC(=O)Nc4ccc(C(N)=O)cc4)=NC32)cc1 |
| InChI | InChI=1S/C21H20N6O5/c1-32-16-8-6-15(7-9-16)25-10-11-26-19(30)20(31)27(24-21(25)26)12-17(28)23-14-4-2-13(3-5-14)18(22)29/h2-9,21H,10-12H2,1H3,(H2-,22,23,28,29)/p+1 |
| InChIKey | WDVCNHAFLOQXFM-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|