C13H18N2O4 — CID 106671846
2-(3,4-dihydroxypyrrolidin-1-yl)-N-(4-methoxyphenyl)acetamide (PubChem CID 106671846) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(3,4-dihydroxypyrrolidin-1-yl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(3,4-dihydroxypyrrolidin-1-yl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 106671846 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(3,4-dihydroxypyrrolidin-1-yl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2CC(O)C(O)C2)cc1 |
| InChI | InChI=1S/C13H18N2O4/c1-19-10-4-2-9(3-5-10)14-13(18)8-15-6-11(16)12(17)7-15/h2-5,11-12,16-17H,6-8H2,1H3,(H,14,18) |
| InChIKey | XKPJCXJPNRJXML-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |