C18H19N6O5+ — CID 167998578
2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 167998578) has the molecular formula C18H19N6O5+ and a molecular weight of 399.39 g/mol. Its IUPAC name is 2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 167998578 |
| Molecular Formula | C18H19N6O5+ |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[8-(4-methoxyphenyl)-3,4-dioxo-7,8a-dihydro-6H-imidazo[2,1-c][1,2,4]triazin-2-ium-2-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | COc1ccc(N2CCN3C(=O)C(=O)[N+](CC(=O)Nc4cc(C)on4)=NC32)cc1 |
| InChI | InChI=1S/C18H18N6O5/c1-11-9-14(21-29-11)19-15(25)10-24-17(27)16(26)23-8-7-22(18(23)20-24)12-3-5-13(28-2)6-4-12/h3-6,9,18H,7-8,10H2,1-2H3/p+1 |
| InChIKey | CQGZTIRBTGHLOJ-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|