C22H26FN3O3S — CID 55956049
N-(4-fluorophenyl)-2-[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]sulfanylacetamide (PubChem CID 55956049) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 55956049 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]sulfanylacetamide |
| SMILES | COc1ccc(N2CCCN(C(=O)CSCC(=O)Nc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26FN3O3S/c1-29-20-9-7-19(8-10-20)25-11-2-12-26(14-13-25)22(28)16-30-15-21(27)24-18-5-3-17(23)4-6-18/h3-10H,2,11-16H2,1H3,(H,24,27) |
| InChIKey | PZEUVBSOGGAUPY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|