C23H31N4O4+ — CID 8593005
[2-(4-methoxyanilino)-2-oxoethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium (PubChem CID 8593005) has the molecular formula C23H31N4O4+ and a molecular weight of 427.53 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8593005 |
| Molecular Formula | C23H31N4O4+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(NC(=O)C[NH+](C)CC(=O)N2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-25(16-22(28)24-18-4-8-20(30-2)9-5-18)17-23(29)27-14-12-26(13-15-27)19-6-10-21(31-3)11-7-19/h4-11H,12-17H2,1-3H3,(H,24,28)/p+1 |
| InChIKey | PZWFFBSLSQGILF-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|