C21H26ClN4O2+ — CID 9348099
[2-(4-chloroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium (PubChem CID 9348099) has the molecular formula C21H26ClN4O2+ and a molecular weight of 401.92 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9348099 |
| Molecular Formula | C21H26ClN4O2+ |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(Cl)cc1)CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25ClN4O2/c1-24(15-20(27)23-18-9-7-17(22)8-10-18)16-21(28)26-13-11-25(12-14-26)19-5-3-2-4-6-19/h2-10H,11-16H2,1H3,(H,23,27)/p+1 |
| InChIKey | RDEXZHGSRBCOCE-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |