C20H21Cl2N3O2 — CID 19099535
2-chloro-N-[4-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]phenyl]acetamide (PubChem CID 19099535) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 19099535 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-chloro-N-[4-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(CC(=O)N2CCN(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O2/c21-14-19(26)23-17-5-1-15(2-6-17)13-20(27)25-11-9-24(10-12-25)18-7-3-16(22)4-8-18/h1-8H,9-14H2,(H,23,26) |
| InChIKey | KALYWLOQZRPHFQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|