C24H19ClF5N3O — CID 17118263
2-(4-chlorophenyl)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 17118263) has the molecular formula C24H19ClF5N3O and a molecular weight of 495.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 17118263 |
| Molecular Formula | C24H19ClF5N3O |
| Molecular Weight | 495.88 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C24H19ClF5N3O/c25-15-3-1-14(2-4-15)13-18(34)31-16-5-7-17(8-6-16)32-9-11-33(12-10-32)24-22(29)20(27)19(26)21(28)23(24)30/h1-8H,9-13H2,(H,31,34) |
| InChIKey | FKOLJNSNNBGRNV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|