C23H30N4O — CID 110409810
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 110409810) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110409810 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)Cc3ccc(N4CCCC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H30N4O/c1-25-14-16-27(17-15-25)22-10-6-20(7-11-22)24-23(28)18-19-4-8-21(9-5-19)26-12-2-3-13-26/h4-11H,2-3,12-18H2,1H3,(H,24,28) |
| InChIKey | ROVLMQISQHVGNM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|