C19H22N2O — CID 110649572
N-(3-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 110649572) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | N-(3-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110649572 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-(3-methylphenyl)-2-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2ccc(N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C19H22N2O/c1-15-5-4-6-17(13-15)20-19(22)14-16-7-9-18(10-8-16)21-11-2-3-12-21/h4-10,13H,2-3,11-12,14H2,1H3,(H,20,22) |
| InChIKey | YFSIAVCQLMLVHG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|