C23H13F10N3O — CID 4232337
2,3,4,5,6-pentafluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 4232337) has the molecular formula C23H13F10N3O and a molecular weight of 537.36 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4232337 |
| Molecular Formula | C23H13F10N3O |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H13F10N3O/c24-12-11(13(25)15(27)16(28)14(12)26)23(37)34-9-1-3-10(4-2-9)35-5-7-36(8-6-35)22-20(32)18(30)17(29)19(31)21(22)33/h1-4H,5-8H2,(H,34,37) |
| InChIKey | NJZPSIAQXGCNEI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|