C24H18ClF5N4OS — CID 17318223
3-chloro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17318223) has the molecular formula C24H18ClF5N4OS and a molecular weight of 540.95 g/mol. Its IUPAC name is 3-chloro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17318223 |
| Molecular Formula | C24H18ClF5N4OS |
| Molecular Weight | 540.95 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 3-chloro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H18ClF5N4OS/c25-14-3-1-2-13(12-14)23(35)32-24(36)31-15-4-6-16(7-5-15)33-8-10-34(11-9-33)22-20(29)18(27)17(26)19(28)21(22)30/h1-7,12H,8-11H2,(H2,31,32,35,36) |
| InChIKey | XOHUGAASLSKZTF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|