C26H22BrF5N4O2S — CID 17318243
3-bromo-4-ethoxy-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17318243) has the molecular formula C26H22BrF5N4O2S and a molecular weight of 629.45 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17318243 |
| Molecular Formula | C26H22BrF5N4O2S |
| Molecular Weight | 629.45 g/mol |
| Exact Mass | 628.06 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(c4c(F)c(F)c(F)c(F)c4F)CC3)cc2)cc1Br |
| InChI | InChI=1S/C26H22BrF5N4O2S/c1-2-38-18-8-3-14(13-17(18)27)25(37)34-26(39)33-15-4-6-16(7-5-15)35-9-11-36(12-10-35)24-22(31)20(29)19(28)21(30)23(24)32/h3-8,13H,2,9-12H2,1H3,(H2,33,34,37,39) |
| InChIKey | XWPQGRBXJVPFOD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|