C21H25BrN4O2S — CID 21216627
3-bromo-N-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 21216627) has the molecular formula C21H25BrN4O2S and a molecular weight of 477.43 g/mol. Its IUPAC name is 3-bromo-N-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 21216627 |
| Molecular Formula | C21H25BrN4O2S |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 3-bromo-N-[[4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)c3ccc(OC)c(Br)c3)cc2)CC1 |
| InChI | InChI=1S/C21H25BrN4O2S/c1-3-25-10-12-26(13-11-25)17-7-5-16(6-8-17)23-21(29)24-20(27)15-4-9-19(28-2)18(22)14-15/h4-9,14H,3,10-13H2,1-2H3,(H2,23,24,27,29) |
| InChIKey | HJBPZPYHFNDZAJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|