C27H27ClN4O4S — CID 17128107
3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17128107) has the molecular formula C27H27ClN4O4S and a molecular weight of 539.06 g/mol. Its IUPAC name is 3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17128107 |
| Molecular Formula | C27H27ClN4O4S |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 3-chloro-N-[[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(c3ccc(NC(=S)NC(=O)c4cccc(Cl)c4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H27ClN4O4S/c1-35-23-15-19(16-24(17-23)36-2)26(34)32-12-10-31(11-13-32)22-8-6-21(7-9-22)29-27(37)30-25(33)18-4-3-5-20(28)14-18/h3-9,14-17H,10-13H2,1-2H3,(H2,29,30,33,37) |
| InChIKey | AHKHUZNSESUMKX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|