C30H35N3O5 — CID 17128061
N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-3-(2-methylpropoxy)benzamide (PubChem CID 17128061) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-3-(2-methylpropoxy)benzamide.
| Compound Name | N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-3-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17128061 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-3-(2-methylpropoxy)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(c3ccc(NC(=O)c4cccc(OCC(C)C)c4)cc3)CC2)c1 |
| InChI | InChI=1S/C30H35N3O5/c1-21(2)20-38-26-7-5-6-22(16-26)29(34)31-24-8-10-25(11-9-24)32-12-14-33(15-13-32)30(35)23-17-27(36-3)19-28(18-23)37-4/h5-11,16-19,21H,12-15,20H2,1-4H3,(H,31,34) |
| InChIKey | LAYDUUUXCRUHQM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|