C24H16F6N4O — CID 17118267
4-cyano-2-fluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17118267) has the molecular formula C24H16F6N4O and a molecular weight of 490.41 g/mol. Its IUPAC name is 4-cyano-2-fluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 4-cyano-2-fluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17118267 |
| Molecular Formula | C24H16F6N4O |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 4-cyano-2-fluoro-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(N3CCN(c4c(F)c(F)c(F)c(F)c4F)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C24H16F6N4O/c25-17-11-13(12-31)1-6-16(17)24(35)32-14-2-4-15(5-3-14)33-7-9-34(10-8-33)23-21(29)19(27)18(26)20(28)22(23)30/h1-6,11H,7-10H2,(H,32,35) |
| InChIKey | WPUJHTARGBPMFT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|