C16H23N4O4+ — CID 8693187
methyl-(2-morpholin-4-yl-2-oxoethyl)-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium (PubChem CID 8693187) has the molecular formula C16H23N4O4+ and a molecular weight of 335.38 g/mol. Its IUPAC name is methyl-(2-morpholin-4-yl-2-oxoethyl)-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium.
| Compound Name | methyl-(2-morpholin-4-yl-2-oxoethyl)-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8693187 |
| Molecular Formula | C16H23N4O4+ |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl-(2-morpholin-4-yl-2-oxoethyl)-[2-oxo-2-(phenylcarbamoylamino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)NC(=O)Nc1ccccc1)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H22N4O4/c1-19(12-15(22)20-7-9-24-10-8-20)11-14(21)18-16(23)17-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H2,17,18,21,23)/p+1 |
| InChIKey | NUSXGTIWWHKOFP-UHFFFAOYSA-O |
| XLogP | -1.29 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |