C14H27N4O4+ — CID 8711610
[2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium (PubChem CID 8711610) has the molecular formula C14H27N4O4+ and a molecular weight of 315.39 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 8711610 |
| Molecular Formula | C14H27N4O4+ |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
| SMILES | C[NH+](CC(=O)NC(=O)NC(C)(C)C)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H26N4O4/c1-14(2,3)16-13(21)15-11(19)9-17(4)10-12(20)18-5-7-22-8-6-18/h5-10H2,1-4H3,(H2,15,16,19,21)/p+1 |
| InChIKey | IYAZKXHDXLIJAZ-UHFFFAOYSA-O |
| XLogP | -2.02 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |