C18H26N3O5+ — CID 8711432
[2-(4-ethoxycarbonylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium (PubChem CID 8711432) has the molecular formula C18H26N3O5+ and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-(4-ethoxycarbonylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium.
| Compound Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 8711432 |
| Molecular Formula | C18H26N3O5+ |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[NH+](C)CC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H25N3O5/c1-3-26-18(24)14-4-6-15(7-5-14)19-16(22)12-20(2)13-17(23)21-8-10-25-11-9-21/h4-7H,3,8-13H2,1-2H3,(H,19,22)/p+1 |
| InChIKey | FBVXKIUBYPTHOF-UHFFFAOYSA-O |
| XLogP | -0.82 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |