C22H28N3O4+ — CID 8588118
methyl-[2-(4-methylanilino)-2-oxoethyl]-[2-oxo-2-(4-propoxycarbonylanilino)ethyl]azanium (PubChem CID 8588118) has the molecular formula C22H28N3O4+ and a molecular weight of 398.48 g/mol. Its IUPAC name is methyl-[2-(4-methylanilino)-2-oxoethyl]-[2-oxo-2-(4-propoxycarbonylanilino)ethyl]azanium.
| Compound Name | methyl-[2-(4-methylanilino)-2-oxoethyl]-[2-oxo-2-(4-propoxycarbonylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8588118 |
| Molecular Formula | C22H28N3O4+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | methyl-[2-(4-methylanilino)-2-oxoethyl]-[2-oxo-2-(4-propoxycarbonylanilino)ethyl]azanium |
| SMILES | CCCOC(=O)c1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-4-13-29-22(28)17-7-11-19(12-8-17)24-21(27)15-25(3)14-20(26)23-18-9-5-16(2)6-10-18/h5-12H,4,13-15H2,1-3H3,(H,23,26)(H,24,27)/p+1 |
| InChIKey | XKOFTDWXOPETEN-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |