C16H23NO4 — CID 103021711
propyl 4-[(3-methoxy-3-methylbutanoyl)amino]benzoate (PubChem CID 103021711) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is propyl 4-[(3-methoxy-3-methylbutanoyl)amino]benzoate.
| Compound Name | propyl 4-[(3-methoxy-3-methylbutanoyl)amino]benzoate |
|---|---|
| PubChem CID | 103021711 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | propyl 4-[(3-methoxy-3-methylbutanoyl)amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CC(C)(C)OC)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-5-10-21-15(19)12-6-8-13(9-7-12)17-14(18)11-16(2,3)20-4/h6-9H,5,10-11H2,1-4H3,(H,17,18) |
| InChIKey | YFALUDJGDRACSG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |