C19H31N4O3+ — CID 9029948
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium (PubChem CID 9029948) has the molecular formula C19H31N4O3+ and a molecular weight of 363.48 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9029948 |
| Molecular Formula | C19H31N4O3+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
| SMILES | COc1ccc(N2CCN(C(=O)C[NH+](C)CC(=O)NC(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H30N4O3/c1-15(2)20-18(24)13-21(3)14-19(25)23-11-9-22(10-12-23)16-5-7-17(26-4)8-6-16/h5-8,15H,9-14H2,1-4H3,(H,20,24)/p+1 |
| InChIKey | VJOQSYSJSMSBNW-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|