C21H27FN3O2+ — CID 8593037
(4-fluorophenyl)methyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium (PubChem CID 8593037) has the molecular formula C21H27FN3O2+ and a molecular weight of 372.46 g/mol. Its IUPAC name is (4-fluorophenyl)methyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium.
| Compound Name | (4-fluorophenyl)methyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8593037 |
| Molecular Formula | C21H27FN3O2+ |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (4-fluorophenyl)methyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(N2CCN(C(=O)C[NH+](C)Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H26FN3O2/c1-23(15-17-3-5-18(22)6-4-17)16-21(26)25-13-11-24(12-14-25)19-7-9-20(27-2)10-8-19/h3-10H,11-16H2,1-2H3/p+1 |
| InChIKey | BKYIBTGTCXXFJM-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 37.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|