C23H28N5O3+ — CID 135600131
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135600131) has the molecular formula C23H28N5O3+ and a molecular weight of 422.51 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135600131 |
| Molecular Formula | C23H28N5O3+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | COc1ccc(N2CCN(C(=O)C[NH+](C)Cc3nc4ccccc4c(=O)[nH]3)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O3/c1-26(15-21-24-20-6-4-3-5-19(20)23(30)25-21)16-22(29)28-13-11-27(12-14-28)17-7-9-18(31-2)10-8-17/h3-10H,11-16H2,1-2H3,(H,24,25,30)/p+1 |
| InChIKey | MKJALFONUFPNAG-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|