C24H30N5O2+ — CID 135625120
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135625120) has the molecular formula C24H30N5O2+ and a molecular weight of 420.54 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135625120 |
| Molecular Formula | C24H30N5O2+ |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(N2CCCCCC2)cc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H29N5O2/c1-28(16-22-26-21-9-5-4-8-20(21)24(31)27-22)17-23(30)25-18-10-12-19(13-11-18)29-14-6-2-3-7-15-29/h4-5,8-13H,2-3,6-7,14-17H2,1H3,(H,25,30)(H,26,27,31)/p+1 |
| InChIKey | WNSKEUMZFLGZSH-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|