C27H25FN4O2S — CID 23795484
2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 23795484) has the molecular formula C27H25FN4O2S and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 23795484 |
| Molecular Formula | C27H25FN4O2S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccccc1F)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H25FN4O2S/c28-22-9-3-5-11-24(22)32-26(34)21-8-2-4-10-23(21)30-27(32)35-18-25(33)29-19-12-14-20(15-13-19)31-16-6-1-7-17-31/h2-5,8-15H,1,6-7,16-18H2,(H,29,33) |
| InChIKey | VODJTFSTIAZCJR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|