C26H30N4O3S — CID 4818132
2-[4-oxo-3-(oxolan-2-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 4818132) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 2-[4-oxo-3-(oxolan-2-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-oxo-3-(oxolan-2-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4818132 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[4-oxo-3-(oxolan-2-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CC1CCCO1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H30N4O3S/c31-24(27-19-10-12-20(13-11-19)29-14-4-1-5-15-29)18-34-26-28-23-9-3-2-8-22(23)25(32)30(26)17-21-7-6-16-33-21/h2-3,8-13,21H,1,4-7,14-18H2,(H,27,31) |
| InChIKey | HEUGBBHMSWNPCR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|