C29H30N4O4S — CID 2495997
2-[3-(2,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 2495997) has the molecular formula C29H30N4O4S and a molecular weight of 530.65 g/mol. Its IUPAC name is 2-[3-(2,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[3-(2,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2495997 |
| Molecular Formula | C29H30N4O4S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 2-[3-(2,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | COc1ccc(OC)c(-n2c(SCC(=O)Nc3ccc(N4CCCCC4)cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C29H30N4O4S/c1-36-22-14-15-26(37-2)25(18-22)33-28(35)23-8-4-5-9-24(23)31-29(33)38-19-27(34)30-20-10-12-21(13-11-20)32-16-6-3-7-17-32/h4-5,8-15,18H,3,6-7,16-17,19H2,1-2H3,(H,30,34) |
| InChIKey | IJPJIRGMMKTHIZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|