C22H14F2IN3O2S — CID 23935266
2-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide (PubChem CID 23935266) has the molecular formula C22H14F2IN3O2S and a molecular weight of 549.34 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 23935266 |
| Molecular Formula | C22H14F2IN3O2S |
| Molecular Weight | 549.34 g/mol |
| Exact Mass | 548.98 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1F)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C22H14F2IN3O2S/c23-13-5-10-19(17(24)11-13)28-21(30)16-3-1-2-4-18(16)27-22(28)31-12-20(29)26-15-8-6-14(25)7-9-15/h1-11H,12H2,(H,26,29) |
| InChIKey | RZVHDYBOFUELKG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|