C28H27FN4O3S2 — CID 42743916
3-(4-fluorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]quinazolin-4-one (PubChem CID 42743916) has the molecular formula C28H27FN4O3S2 and a molecular weight of 550.68 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(4-fluorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42743916 |
| Molecular Formula | C28H27FN4O3S2 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]quinazolin-4-one |
| SMILES | COc1ccc(N2CCN(C(=O)CSCSc3nc4ccccc4c(=O)n3-c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H27FN4O3S2/c1-36-23-12-10-21(11-13-23)31-14-16-32(17-15-31)26(34)18-37-19-38-28-30-25-5-3-2-4-24(25)27(35)33(28)22-8-6-20(29)7-9-22/h2-13H,14-19H2,1H3 |
| InChIKey | QHRBUJVINNIMHM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|