C22H22FN3O2S — CID 5168931
3-(4-fluorophenyl)-2-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 5168931) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(4-fluorophenyl)-2-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 5168931 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | CC1CCN(C(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-15-10-12-25(13-11-15)20(27)14-29-22-24-19-5-3-2-4-18(19)21(28)26(22)17-8-6-16(23)7-9-17/h2-9,15H,10-14H2,1H3 |
| InChIKey | BQKDLXZVIIODNP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |