C20H16FN3O3S — CID 2631716
3-(4-fluorophenyl)-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-4-one (PubChem CID 2631716) has the molecular formula C20H16FN3O3S and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(4-fluorophenyl)-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2631716 |
| Molecular Formula | C20H16FN3O3S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-4-one |
| SMILES | O=C1CCCN1C(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FN3O3S/c21-13-7-9-14(10-8-13)24-19(27)15-4-1-2-5-16(15)22-20(24)28-12-18(26)23-11-3-6-17(23)25/h1-2,4-5,7-10H,3,6,11-12H2 |
| InChIKey | HNSRZNFVYUUREN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |