C18H19N3O5S — CID 9066349
methyl 3-[4-oxo-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-3-yl]propanoate (PubChem CID 9066349) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl 3-[4-oxo-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-3-yl]propanoate.
| Compound Name | methyl 3-[4-oxo-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-3-yl]propanoate |
|---|---|
| PubChem CID | 9066349 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | methyl 3-[4-oxo-2-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]sulfanylquinazolin-3-yl]propanoate |
| SMILES | COC(=O)CCn1c(SCC(=O)N2CCCC2=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H19N3O5S/c1-26-16(24)8-10-21-17(25)12-5-2-3-6-13(12)19-18(21)27-11-15(23)20-9-4-7-14(20)22/h2-3,5-6H,4,7-11H2,1H3 |
| InChIKey | LCPIXTWQPATCEJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |